C15H18O8 — CID 70297612
7-[3-(2-methoxy-2-oxoacetyl)-2,4,5-trioxocyclopentyl]heptanoic acid (PubChem CID 70297612) has the molecular formula C15H18O8 and a molecular weight of 326.30 g/mol. Its IUPAC name is 7-[3-(2-methoxy-2-oxoacetyl)-2,4,5-trioxocyclopentyl]heptanoic acid.
| Compound Name | 7-[3-(2-methoxy-2-oxoacetyl)-2,4,5-trioxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70297612 |
| Molecular Formula | C15H18O8 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 7-[3-(2-methoxy-2-oxoacetyl)-2,4,5-trioxocyclopentyl]heptanoic acid |
| SMILES | COC(=O)C(=O)C1C(=O)C(=O)C(CCCCCCC(=O)O)C1=O |
| InChI | InChI=1S/C15H18O8/c1-23-15(22)14(21)10-11(18)8(12(19)13(10)20)6-4-2-3-5-7-9(16)17/h8,10H,2-7H2,1H3,(H,16,17) |
| InChIKey | LFMPQNTXQKMBIJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|