C30H39NO5 — CID 98135493
[(4S,4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] undec-10-enoate (PubChem CID 98135493) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is [(4S,4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] undec-10-enoate.
| Compound Name | [(4S,4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] undec-10-enoate |
|---|---|
| PubChem CID | 98135493 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | [(4S,4aS,7aR,12bS)-4a-hydroxy-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)Oc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(O)[C@H](C2)N(CC=C)CC[C@]314 |
| InChI | InChI=1S/C30H39NO5/c1-3-5-6-7-8-9-10-11-12-25(33)35-23-14-13-21-20-24-30(34)16-15-22(32)28-29(30,26(21)27(23)36-28)17-19-31(24)18-4-2/h3-4,13-14,24,28,34H,1-2,5-12,15-20H2/t24-,28-,29-,30+/m0/s1 |
| InChIKey | DQQNIOSHMHOPOK-DNEFNOKRSA-N |
| XLogP | 4.81 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|