C38H55NO5 — CID 139557201
[3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] (Z)-octadec-9-enoate (PubChem CID 139557201) has the molecular formula C38H55NO5 and a molecular weight of 605.86 g/mol. Its IUPAC name is [3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] (Z)-octadec-9-enoate.
| Compound Name | [3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 139557201 |
| Molecular Formula | C38H55NO5 |
| Molecular Weight | 605.86 g/mol |
| Exact Mass | 605.41 |
| IUPAC Name | [3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc2c3c1OC1C(=O)CCC4(O)C(C2)N(CC2CC2)CCC314 |
| InChI | InChI=1S/C38H55NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-33(41)43-31-21-20-29-26-32-38(42)23-22-30(40)36-37(38,34(29)35(31)44-36)24-25-39(32)27-28-18-19-28/h9-10,20-21,28,32,36,42H,2-8,11-19,22-27H2,1H3/b10-9- |
| InChIKey | UOTVZKZSVMPFLO-KTKRTIGZSA-N |
| XLogP | 7.76 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.86 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|