C40H61NO4 — CID 139572719
[(1S,2S,15S)-2-but-1-en-2-yl-11-(cyclopropylmethyl)-15-hydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-yl] (E)-octadec-9-enoate (PubChem CID 139572719) has the molecular formula C40H61NO4 and a molecular weight of 619.93 g/mol. Its IUPAC name is [(1S,2S,15S)-2-but-1-en-2-yl-11-(cyclopropylmethyl)-15-hydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-yl] (E)-octadec-9-enoate.
| Compound Name | [(1S,2S,15S)-2-but-1-en-2-yl-11-(cyclopropylmethyl)-15-hydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-yl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 139572719 |
| Molecular Formula | C40H61NO4 |
| Molecular Weight | 619.93 g/mol |
| Exact Mass | 619.46 |
| IUPAC Name | [(1S,2S,15S)-2-but-1-en-2-yl-11-(cyclopropylmethyl)-15-hydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-yl] (E)-octadec-9-enoate |
| SMILES | C=C(CC)[C@@H]1Oc2c(OC(=O)CCCCCCC/C=C/CCCCCCCC)ccc3c2[C@@]12CCN(CC1CC1)C(C3)[C@@]2(C)O |
| InChI | InChI=1S/C40H61NO4/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-35(42)44-33-25-24-32-28-34-39(4,43)40(26-27-41(34)29-31-22-23-31)36(32)37(33)45-38(40)30(3)6-2/h13-14,24-25,31,34,38,43H,3,5-12,15-23,26-29H2,1-2,4H3/b14-13+/t34?,38-,39+,40-/m0/s1 |
| InChIKey | ZAAJQVKQPJBVGW-USSJMOHTSA-N |
| XLogP | 9.39 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.93 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|