C32H47NO4 — CID 143881331
[2-but-1-en-2-yl-11-(cyclopropylmethyl)-15-hydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-yl] decanoate (PubChem CID 143881331) has the molecular formula C32H47NO4 and a molecular weight of 509.73 g/mol. Its IUPAC name is [2-but-1-en-2-yl-11-(cyclopropylmethyl)-15-hydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-yl] decanoate.
| Compound Name | [2-but-1-en-2-yl-11-(cyclopropylmethyl)-15-hydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-yl] decanoate |
|---|---|
| PubChem CID | 143881331 |
| Molecular Formula | C32H47NO4 |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.35 |
| IUPAC Name | [2-but-1-en-2-yl-11-(cyclopropylmethyl)-15-hydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-yl] decanoate |
| SMILES | C=C(CC)C1Oc2c(OC(=O)CCCCCCCCC)ccc3c2C12CCN(CC1CC1)C(C3)C2(C)O |
| InChI | InChI=1S/C32H47NO4/c1-5-7-8-9-10-11-12-13-27(34)36-25-17-16-24-20-26-31(4,35)32(18-19-33(26)21-23-14-15-23)28(24)29(25)37-30(32)22(3)6-2/h16-17,23,26,30,35H,3,5-15,18-21H2,1-2,4H3 |
| InChIKey | WDIGDYUZFHMXBO-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|