C18H21N3O3S2 — CID 98150599
(1R,2S,4S)-N-[6-(propan-2-ylsulfamoyl)-1,3-benzothiazol-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98150599) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is (1R,2S,4S)-N-[6-(propan-2-ylsulfamoyl)-1,3-benzothiazol-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,4S)-N-[6-(propan-2-ylsulfamoyl)-1,3-benzothiazol-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98150599 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (1R,2S,4S)-N-[6-(propan-2-ylsulfamoyl)-1,3-benzothiazol-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc2nc(NC(=O)[C@H]3C[C@H]4C=C[C@H]3C4)sc2c1 |
| InChI | InChI=1S/C18H21N3O3S2/c1-10(2)21-26(23,24)13-5-6-15-16(9-13)25-18(19-15)20-17(22)14-8-11-3-4-12(14)7-11/h3-6,9-12,14,21H,7-8H2,1-2H3,(H,19,20,22)/t11-,12-,14-/m0/s1 |
| InChIKey | FBQAIXURJXJORP-OBJOEFQTSA-N |
| XLogP | 3.13 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|