C39H28N2O5 — CID 98156488
(1R,2S,6S,7R,8S,9S)-4-(2-nitrophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]decane-3,5,10-trione (PubChem CID 98156488) has the molecular formula C39H28N2O5 and a molecular weight of 604.66 g/mol. Its IUPAC name is (1R,2S,6S,7R,8S,9S)-4-(2-nitrophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]decane-3,5,10-trione.
| Compound Name | (1R,2S,6S,7R,8S,9S)-4-(2-nitrophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]decane-3,5,10-trione |
|---|---|
| PubChem CID | 98156488 |
| Molecular Formula | C39H28N2O5 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | (1R,2S,6S,7R,8S,9S)-4-(2-nitrophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]decane-3,5,10-trione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1c1ccccc1[N+](=O)[O-])[C@]1(c3ccccc3)C(=O)[C@]2(c2ccccc2)[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C39H28N2O5/c42-35-33-34(36(43)40(35)29-23-13-14-24-30(29)41(45)46)39(28-21-11-4-12-22-28)32(26-17-7-2-8-18-26)31(25-15-5-1-6-16-25)38(33,37(39)44)27-19-9-3-10-20-27/h1-24,31-34H/t31-,32-,33-,34-,38-,39-/m1/s1 |
| InChIKey | FPGOEXLAEHZMDK-ZHYVTBQMSA-N |
| XLogP | 6.74 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|