C23H33N3O — CID 98157270
(NE)-N-[(4E,8E,12S)-12-(4-benzylpiperazin-1-yl)cyclododeca-4,8-dien-1-ylidene]hydroxylamine (PubChem CID 98157270) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is (NE)-N-[(4E,8E,12S)-12-(4-benzylpiperazin-1-yl)cyclododeca-4,8-dien-1-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4E,8E,12S)-12-(4-benzylpiperazin-1-yl)cyclododeca-4,8-dien-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 98157270 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | (NE)-N-[(4E,8E,12S)-12-(4-benzylpiperazin-1-yl)cyclododeca-4,8-dien-1-ylidene]hydroxylamine |
| SMILES | O/N=C1\CC/C=C/CC/C=C/CC[C@@H]1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H33N3O/c27-24-22-14-10-5-3-1-2-4-6-11-15-23(22)26-18-16-25(17-19-26)20-21-12-8-7-9-13-21/h3-9,12-13,23,27H,1-2,10-11,14-20H2/b5-3+,6-4+,24-22+/t23-/m0/s1 |
| InChIKey | ZIAZVJXASDLHHH-XNLVIRCSSA-N |
| XLogP | 4.47 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|