C25H24N2O5 — CID 98157789
(3aR,7aS)-2-[3-[2-[(3R)-3-hydroxy-5-methyl-2-oxo-1H-indol-3-yl]acetyl]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 98157789) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is (3aR,7aS)-2-[3-[2-[(3R)-3-hydroxy-5-methyl-2-oxo-1H-indol-3-yl]acetyl]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-[3-[2-[(3R)-3-hydroxy-5-methyl-2-oxo-1H-indol-3-yl]acetyl]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 98157789 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (3aR,7aS)-2-[3-[2-[(3R)-3-hydroxy-5-methyl-2-oxo-1H-indol-3-yl]acetyl]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)[C@](O)(CC(=O)c1cccc(N3C(=O)[C@H]4CCCC[C@H]4C3=O)c1)C(=O)N2 |
| InChI | InChI=1S/C25H24N2O5/c1-14-9-10-20-19(11-14)25(32,24(31)26-20)13-21(28)15-5-4-6-16(12-15)27-22(29)17-7-2-3-8-18(17)23(27)30/h4-6,9-12,17-18,32H,2-3,7-8,13H2,1H3,(H,26,31)/t17-,18+,25-/m1/s1 |
| InChIKey | LGVKFEIWERXAHA-FUMQJTLXSA-N |
| XLogP | 3.09 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|