C15H13N — CID 98163757
(1S,2R,9R,10R,13S,14S)-pentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6-triene-6-carbonitrile (PubChem CID 98163757) has the molecular formula C15H13N and a molecular weight of 207.28 g/mol. Its IUPAC name is (1S,2R,9R,10R,13S,14S)-pentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6-triene-6-carbonitrile.
| Compound Name | (1S,2R,9R,10R,13S,14S)-pentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6-triene-6-carbonitrile |
|---|---|
| PubChem CID | 98163757 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (1S,2R,9R,10R,13S,14S)-pentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6-triene-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)[C@@H]1[C@@H]3CC[C@@H]3[C@@H]3[C@@H]2[C@@H]13 |
| InChI | InChI=1S/C15H13N/c16-6-7-1-2-10-11(5-7)12-8-3-4-9(8)13-14(10)15(12)13/h1-2,5,8-9,12-15H,3-4H2/t8-,9+,12+,13-,14-,15+/m1/s1 |
| InChIKey | UAMXDFMEEJJIGE-NMVPSPRLSA-N |
| XLogP | 3.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'} |
|---|