C12H9N — CID 98153800
(1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-4-carbonitrile (PubChem CID 98153800) has the molecular formula C12H9N and a molecular weight of 167.21 g/mol. Its IUPAC name is (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-4-carbonitrile.
| Compound Name | (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-4-carbonitrile |
|---|---|
| PubChem CID | 98153800 |
| Molecular Formula | C12H9N |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | (1S,8S)-tricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-4-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)[C@@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C12H9N/c13-7-8-1-4-11-9-2-3-10(6-9)12(11)5-8/h1-5,9-10H,6H2/t9-,10-/m1/s1 |
| InChIKey | JYHOGTDMPYFPGQ-NXEZZACHSA-N |
| XLogP | 2.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|