C16H15FN2O2S — CID 98168368
(E,2R)-5-(4-fluorophenyl)-3-oxo-2-(thiomorpholine-4-carbonyl)pent-4-enenitrile (PubChem CID 98168368) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is (E,2R)-5-(4-fluorophenyl)-3-oxo-2-(thiomorpholine-4-carbonyl)pent-4-enenitrile.
| Compound Name | (E,2R)-5-(4-fluorophenyl)-3-oxo-2-(thiomorpholine-4-carbonyl)pent-4-enenitrile |
|---|---|
| PubChem CID | 98168368 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (E,2R)-5-(4-fluorophenyl)-3-oxo-2-(thiomorpholine-4-carbonyl)pent-4-enenitrile |
| SMILES | N#C[C@H](C(=O)/C=C/c1ccc(F)cc1)C(=O)N1CCSCC1 |
| InChI | InChI=1S/C16H15FN2O2S/c17-13-4-1-12(2-5-13)3-6-15(20)14(11-18)16(21)19-7-9-22-10-8-19/h1-6,14H,7-10H2/b6-3+/t14-/m1/s1 |
| InChIKey | QMNDVUBSSMFEJI-BOTMBNHJSA-N |
| XLogP | 2.12 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|