C27H33F2NOS3 — CID 44623338
(E)-1-(3,5-difluorophenyl)-3-[4-(1,5,9-trithia-13-azacyclohexadec-13-yl)phenyl]prop-2-en-1-one (PubChem CID 44623338) has the molecular formula C27H33F2NOS3 and a molecular weight of 521.76 g/mol. Its IUPAC name is (E)-1-(3,5-difluorophenyl)-3-[4-(1,5,9-trithia-13-azacyclohexadec-13-yl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,5-difluorophenyl)-3-[4-(1,5,9-trithia-13-azacyclohexadec-13-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 44623338 |
| Molecular Formula | C27H33F2NOS3 |
| Molecular Weight | 521.76 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | (E)-1-(3,5-difluorophenyl)-3-[4-(1,5,9-trithia-13-azacyclohexadec-13-yl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(N2CCCSCCCSCCCSCCC2)cc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C27H33F2NOS3/c28-24-19-23(20-25(29)21-24)27(31)10-7-22-5-8-26(9-6-22)30-11-1-13-32-15-3-17-34-18-4-16-33-14-2-12-30/h5-10,19-21H,1-4,11-18H2/b10-7+ |
| InChIKey | KSGROTLOOZEEEF-JXMROGBWSA-N |
| XLogP | 7.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.76 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|