C24H24N2O3 — CID 98176206
(3S)-1-[(3,4-dimethoxyphenyl)methyl-methylamino]-3-phenyl-3H-indol-2-one (PubChem CID 98176206) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is (3S)-1-[(3,4-dimethoxyphenyl)methyl-methylamino]-3-phenyl-3H-indol-2-one.
| Compound Name | (3S)-1-[(3,4-dimethoxyphenyl)methyl-methylamino]-3-phenyl-3H-indol-2-one |
|---|---|
| PubChem CID | 98176206 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (3S)-1-[(3,4-dimethoxyphenyl)methyl-methylamino]-3-phenyl-3H-indol-2-one |
| SMILES | COc1ccc(CN(C)N2C(=O)[C@@H](c3ccccc3)c3ccccc32)cc1OC |
| InChI | InChI=1S/C24H24N2O3/c1-25(16-17-13-14-21(28-2)22(15-17)29-3)26-20-12-8-7-11-19(20)23(24(26)27)18-9-5-4-6-10-18/h4-15,23H,16H2,1-3H3/t23-/m0/s1 |
| InChIKey | ARSAIYOABICXIW-QHCPKHFHSA-N |
| XLogP | 4.23 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |