C35H39ClN2O4S — CID 23317460
2-[2-[4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]butoxy]phenyl]-4-phenyl-4H-1,2-benzothiazin-3-one;hydrochloride (PubChem CID 23317460) has the molecular formula C35H39ClN2O4S and a molecular weight of 619.23 g/mol. Its IUPAC name is 2-[2-[4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]butoxy]phenyl]-4-phenyl-4H-1,2-benzothiazin-3-one;hydrochloride.
| Compound Name | 2-[2-[4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]butoxy]phenyl]-4-phenyl-4H-1,2-benzothiazin-3-one;hydrochloride |
|---|---|
| PubChem CID | 23317460 |
| Molecular Formula | C35H39ClN2O4S |
| Molecular Weight | 619.23 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | 2-[2-[4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]butoxy]phenyl]-4-phenyl-4H-1,2-benzothiazin-3-one;hydrochloride |
| SMILES | COc1ccc(CCN(C)CCCCOc2ccccc2N2Sc3ccccc3C(c3ccccc3)C2=O)cc1OC.Cl |
| InChI | InChI=1S/C35H38N2O4S.ClH/c1-36(23-21-26-19-20-31(39-2)32(25-26)40-3)22-11-12-24-41-30-17-9-8-16-29(30)37-35(38)34(27-13-5-4-6-14-27)28-15-7-10-18-33(28)42-37;/h4-10,13-20,25,34H,11-12,21-24H2,1-3H3;1H |
| InChIKey | IMLIGOCXVABDBE-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.23 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|