C30H37ClN2O6S — CID 21284326
2-[2-[4-[2-(3,4-dimethoxyphenoxy)ethyl-methylamino]butoxy]-5-methoxyphenyl]-4H-1,4-benzothiazin-3-one;hydrochloride (PubChem CID 21284326) has the molecular formula C30H37ClN2O6S and a molecular weight of 589.15 g/mol. Its IUPAC name is 2-[2-[4-[2-(3,4-dimethoxyphenoxy)ethyl-methylamino]butoxy]-5-methoxyphenyl]-4H-1,4-benzothiazin-3-one;hydrochloride.
| Compound Name | 2-[2-[4-[2-(3,4-dimethoxyphenoxy)ethyl-methylamino]butoxy]-5-methoxyphenyl]-4H-1,4-benzothiazin-3-one;hydrochloride |
|---|---|
| PubChem CID | 21284326 |
| Molecular Formula | C30H37ClN2O6S |
| Molecular Weight | 589.15 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 2-[2-[4-[2-(3,4-dimethoxyphenoxy)ethyl-methylamino]butoxy]-5-methoxyphenyl]-4H-1,4-benzothiazin-3-one;hydrochloride |
| SMILES | COc1ccc(OCCCCN(C)CCOc2ccc(OC)c(OC)c2)c(C2Sc3ccccc3NC2=O)c1.Cl |
| InChI | InChI=1S/C30H36N2O6S.ClH/c1-32(16-18-37-22-12-14-26(35-3)27(20-22)36-4)15-7-8-17-38-25-13-11-21(34-2)19-23(25)29-30(33)31-24-9-5-6-10-28(24)39-29;/h5-6,9-14,19-20,29H,7-8,15-18H2,1-4H3,(H,31,33);1H |
| InChIKey | WPGNXTVWANEDQT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.15 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|