C35H44N2O11S — CID 67919538
2-[2-[4-[ethyl-[2-(2,3,4-trimethoxyphenoxy)ethyl]amino]butoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one;oxalic acid (PubChem CID 67919538) has the molecular formula C35H44N2O11S and a molecular weight of 700.81 g/mol. Its IUPAC name is 2-[2-[4-[ethyl-[2-(2,3,4-trimethoxyphenoxy)ethyl]amino]butoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one;oxalic acid.
| Compound Name | 2-[2-[4-[ethyl-[2-(2,3,4-trimethoxyphenoxy)ethyl]amino]butoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one;oxalic acid |
|---|---|
| PubChem CID | 67919538 |
| Molecular Formula | C35H44N2O11S |
| Molecular Weight | 700.81 g/mol |
| Exact Mass | 700.27 |
| IUPAC Name | 2-[2-[4-[ethyl-[2-(2,3,4-trimethoxyphenoxy)ethyl]amino]butoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one;oxalic acid |
| SMILES | CCN(CCCCOc1ccc(OC)cc1C1Sc2ccccc2N(C)C1=O)CCOc1ccc(OC)c(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C33H42N2O7S.C2H2O4/c1-7-35(19-21-42-28-17-16-27(38-4)30(39-5)31(28)40-6)18-10-11-20-41-26-15-14-23(37-3)22-24(26)32-33(36)34(2)25-12-8-9-13-29(25)43-32;3-1(4)2(5)6/h8-9,12-17,22,32H,7,10-11,18-21H2,1-6H3;(H,3,4)(H,5,6) |
| InChIKey | JLNXQAPFROGPDB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 153.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.81 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|