C21H27N3O3S — CID 139718962
2-[2-[3-(2-aminoethylamino)propoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one (PubChem CID 139718962) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-[2-[3-(2-aminoethylamino)propoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one.
| Compound Name | 2-[2-[3-(2-aminoethylamino)propoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 139718962 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-[2-[3-(2-aminoethylamino)propoxy]-5-methoxyphenyl]-4-methyl-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(OCCCNCCN)c(C2Sc3ccccc3N(C)C2=O)c1 |
| InChI | InChI=1S/C21H27N3O3S/c1-24-17-6-3-4-7-19(17)28-20(21(24)25)16-14-15(26-2)8-9-18(16)27-13-5-11-23-12-10-22/h3-4,6-9,14,20,23H,5,10-13,22H2,1-2H3 |
| InChIKey | XNOHPDFAXLFZPK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|