C27H28N2O6S — CID 101013501
(2S)-2-[2-[3-[2-(1,3-benzodioxol-5-yloxy)ethylamino]propoxy]-5-hydroxyphenyl]-4-methyl-1,4-benzothiazin-3-one (PubChem CID 101013501) has the molecular formula C27H28N2O6S and a molecular weight of 508.60 g/mol. Its IUPAC name is (2S)-2-[2-[3-[2-(1,3-benzodioxol-5-yloxy)ethylamino]propoxy]-5-hydroxyphenyl]-4-methyl-1,4-benzothiazin-3-one.
| Compound Name | (2S)-2-[2-[3-[2-(1,3-benzodioxol-5-yloxy)ethylamino]propoxy]-5-hydroxyphenyl]-4-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 101013501 |
| Molecular Formula | C27H28N2O6S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | (2S)-2-[2-[3-[2-(1,3-benzodioxol-5-yloxy)ethylamino]propoxy]-5-hydroxyphenyl]-4-methyl-1,4-benzothiazin-3-one |
| SMILES | CN1C(=O)[C@H](c2cc(O)ccc2OCCCNCCOc2ccc3c(c2)OCO3)Sc2ccccc21 |
| InChI | InChI=1S/C27H28N2O6S/c1-29-21-5-2-3-6-25(21)36-26(27(29)31)20-15-18(30)7-9-22(20)33-13-4-11-28-12-14-32-19-8-10-23-24(16-19)35-17-34-23/h2-3,5-10,15-16,26,28,30H,4,11-14,17H2,1H3/t26-/m0/s1 |
| InChIKey | RBRMYUMZHRAJAT-SANMLTNESA-N |
| XLogP | 4.37 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|