C29H30N2O9S — CID 14098994
2-[4-[2-[2-(1,3-benzodioxol-5-yloxy)ethyl-methylamino]ethoxy]phenyl]-4-methyl-1,4-benzothiazin-3-one;oxalic acid (PubChem CID 14098994) has the molecular formula C29H30N2O9S and a molecular weight of 582.63 g/mol. Its IUPAC name is 2-[4-[2-[2-(1,3-benzodioxol-5-yloxy)ethyl-methylamino]ethoxy]phenyl]-4-methyl-1,4-benzothiazin-3-one;oxalic acid.
| Compound Name | 2-[4-[2-[2-(1,3-benzodioxol-5-yloxy)ethyl-methylamino]ethoxy]phenyl]-4-methyl-1,4-benzothiazin-3-one;oxalic acid |
|---|---|
| PubChem CID | 14098994 |
| Molecular Formula | C29H30N2O9S |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | 2-[4-[2-[2-(1,3-benzodioxol-5-yloxy)ethyl-methylamino]ethoxy]phenyl]-4-methyl-1,4-benzothiazin-3-one;oxalic acid |
| SMILES | CN(CCOc1ccc(C2Sc3ccccc3N(C)C2=O)cc1)CCOc1ccc2c(c1)OCO2.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H28N2O5S.C2H2O4/c1-28(14-16-32-21-11-12-23-24(17-21)34-18-33-23)13-15-31-20-9-7-19(8-10-20)26-27(30)29(2)22-5-3-4-6-25(22)35-26;3-1(4)2(5)6/h3-12,17,26H,13-16,18H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | GRPFRGQFUGUVGB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|