C27H29FN2O3S — CID 21284309
2-[4-[4-[2-(2-fluorophenoxy)ethylamino]butoxy]phenyl]-4-methyl-1,4-benzothiazin-3-one (PubChem CID 21284309) has the molecular formula C27H29FN2O3S and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-[4-[4-[2-(2-fluorophenoxy)ethylamino]butoxy]phenyl]-4-methyl-1,4-benzothiazin-3-one.
| Compound Name | 2-[4-[4-[2-(2-fluorophenoxy)ethylamino]butoxy]phenyl]-4-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 21284309 |
| Molecular Formula | C27H29FN2O3S |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 2-[4-[4-[2-(2-fluorophenoxy)ethylamino]butoxy]phenyl]-4-methyl-1,4-benzothiazin-3-one |
| SMILES | CN1C(=O)C(c2ccc(OCCCCNCCOc3ccccc3F)cc2)Sc2ccccc21 |
| InChI | InChI=1S/C27H29FN2O3S/c1-30-23-9-3-5-11-25(23)34-26(27(30)31)20-12-14-21(15-13-20)32-18-7-6-16-29-17-19-33-24-10-4-2-8-22(24)28/h2-5,8-15,26,29H,6-7,16-19H2,1H3 |
| InChIKey | OFNYHARRBWWZBB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|