C31H38N2O6S — CID 14089108
1-[2-[5-methoxy-2-[4-[2-(3,4,5-trimethoxyphenyl)ethylamino]butoxy]phenyl]-2H-1,3-benzothiazol-3-yl]ethanone (PubChem CID 14089108) has the molecular formula C31H38N2O6S and a molecular weight of 566.72 g/mol. Its IUPAC name is 1-[2-[5-methoxy-2-[4-[2-(3,4,5-trimethoxyphenyl)ethylamino]butoxy]phenyl]-2H-1,3-benzothiazol-3-yl]ethanone.
| Compound Name | 1-[2-[5-methoxy-2-[4-[2-(3,4,5-trimethoxyphenyl)ethylamino]butoxy]phenyl]-2H-1,3-benzothiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 14089108 |
| Molecular Formula | C31H38N2O6S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 1-[2-[5-methoxy-2-[4-[2-(3,4,5-trimethoxyphenyl)ethylamino]butoxy]phenyl]-2H-1,3-benzothiazol-3-yl]ethanone |
| SMILES | COc1ccc(OCCCCNCCc2cc(OC)c(OC)c(OC)c2)c(C2Sc3ccccc3N2C(C)=O)c1 |
| InChI | InChI=1S/C31H38N2O6S/c1-21(34)33-25-10-6-7-11-29(25)40-31(33)24-20-23(35-2)12-13-26(24)39-17-9-8-15-32-16-14-22-18-27(36-3)30(38-5)28(19-22)37-4/h6-7,10-13,18-20,31-32H,8-9,14-17H2,1-5H3 |
| InChIKey | YHZAHLCAAYMREP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|