C26H34N2O3S — CID 13335802
1-[2-[2-[3-[cyclohexyl(methyl)amino]propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone (PubChem CID 13335802) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is 1-[2-[2-[3-[cyclohexyl(methyl)amino]propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone.
| Compound Name | 1-[2-[2-[3-[cyclohexyl(methyl)amino]propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 13335802 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 1-[2-[2-[3-[cyclohexyl(methyl)amino]propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone |
| SMILES | COc1ccc(OCCCN(C)C2CCCCC2)c(C2Sc3ccccc3N2C(C)=O)c1 |
| InChI | InChI=1S/C26H34N2O3S/c1-19(29)28-23-12-7-8-13-25(23)32-26(28)22-18-21(30-3)14-15-24(22)31-17-9-16-27(2)20-10-5-4-6-11-20/h7-8,12-15,18,20,26H,4-6,9-11,16-17H2,1-3H3 |
| InChIKey | IWKCKEQQVNDKCP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|