C32H45ClN2O6S — CID 144714686
1-[6-chloro-2-[2-[3-[2-ethoxyethyl(propan-2-yl)amino]propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone;5-hydroxyhex-5-en-2-one (PubChem CID 144714686) has the molecular formula C32H45ClN2O6S and a molecular weight of 621.24 g/mol. Its IUPAC name is 1-[6-chloro-2-[2-[3-[2-ethoxyethyl(propan-2-yl)amino]propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone;5-hydroxyhex-5-en-2-one.
| Compound Name | 1-[6-chloro-2-[2-[3-[2-ethoxyethyl(propan-2-yl)amino]propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone;5-hydroxyhex-5-en-2-one |
|---|---|
| PubChem CID | 144714686 |
| Molecular Formula | C32H45ClN2O6S |
| Molecular Weight | 621.24 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | 1-[6-chloro-2-[2-[3-[2-ethoxyethyl(propan-2-yl)amino]propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone;5-hydroxyhex-5-en-2-one |
| SMILES | C=C(O)CCC(C)=O.CCOCCN(CCCOc1ccc(OC)cc1C1Sc2cc(Cl)ccc2N1C(C)=O)C(C)C |
| InChI | InChI=1S/C26H35ClN2O4S.C6H10O2/c1-6-32-15-13-28(18(2)3)12-7-14-33-24-11-9-21(31-5)17-22(24)26-29(19(4)30)23-10-8-20(27)16-25(23)34-26;1-5(7)3-4-6(2)8/h8-11,16-18,26H,6-7,12-15H2,1-5H3;7H,1,3-4H2,2H3 |
| InChIKey | YQVJBYROIVZMRL-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.24 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|