C24H31ClN2O5S — CID 69077911
3-acetyl-5-chloro-2-[2-[3-[2-hydroxyethyl(propan-2-yl)amino]propoxy]-5-methoxyphenyl]-2,5-dihydro-1,3-benzothiazol-4-one (PubChem CID 69077911) has the molecular formula C24H31ClN2O5S and a molecular weight of 495.04 g/mol. Its IUPAC name is 3-acetyl-5-chloro-2-[2-[3-[2-hydroxyethyl(propan-2-yl)amino]propoxy]-5-methoxyphenyl]-2,5-dihydro-1,3-benzothiazol-4-one.
| Compound Name | 3-acetyl-5-chloro-2-[2-[3-[2-hydroxyethyl(propan-2-yl)amino]propoxy]-5-methoxyphenyl]-2,5-dihydro-1,3-benzothiazol-4-one |
|---|---|
| PubChem CID | 69077911 |
| Molecular Formula | C24H31ClN2O5S |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 3-acetyl-5-chloro-2-[2-[3-[2-hydroxyethyl(propan-2-yl)amino]propoxy]-5-methoxyphenyl]-2,5-dihydro-1,3-benzothiazol-4-one |
| SMILES | COc1ccc(OCCCN(CCO)C(C)C)c(C2SC3=C(C(=O)C(Cl)C=C3)N2C(C)=O)c1 |
| InChI | InChI=1S/C24H31ClN2O5S/c1-15(2)26(11-12-28)10-5-13-32-20-8-6-17(31-4)14-18(20)24-27(16(3)29)22-21(33-24)9-7-19(25)23(22)30/h6-9,14-15,19,24,28H,5,10-13H2,1-4H3 |
| InChIKey | NTCCRCFGMXTJPO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|