C28H36N2O4S — CID 14089147
1-[2-[2-[4-(4-benzoylpiperidin-1-yl)butoxy]-5-methoxyphenyl]-1,3-thiazolidin-3-yl]ethanone (PubChem CID 14089147) has the molecular formula C28H36N2O4S and a molecular weight of 496.67 g/mol. Its IUPAC name is 1-[2-[2-[4-(4-benzoylpiperidin-1-yl)butoxy]-5-methoxyphenyl]-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 1-[2-[2-[4-(4-benzoylpiperidin-1-yl)butoxy]-5-methoxyphenyl]-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 14089147 |
| Molecular Formula | C28H36N2O4S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 1-[2-[2-[4-(4-benzoylpiperidin-1-yl)butoxy]-5-methoxyphenyl]-1,3-thiazolidin-3-yl]ethanone |
| SMILES | COc1ccc(OCCCCN2CCC(C(=O)c3ccccc3)CC2)c(C2SCCN2C(C)=O)c1 |
| InChI | InChI=1S/C28H36N2O4S/c1-21(31)30-17-19-35-28(30)25-20-24(33-2)10-11-26(25)34-18-7-6-14-29-15-12-23(13-16-29)27(32)22-8-4-3-5-9-22/h3-5,8-11,20,23,28H,6-7,12-19H2,1-2H3 |
| InChIKey | DRQJGGLIVMKLDO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|