C21H26N2O3S — CID 13335767
1-[2-[2-[3-(dimethylamino)propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone (PubChem CID 13335767) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-[2-[2-[3-(dimethylamino)propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone.
| Compound Name | 1-[2-[2-[3-(dimethylamino)propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 13335767 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[2-[2-[3-(dimethylamino)propoxy]-5-methoxyphenyl]-2H-1,3-benzothiazol-3-yl]ethanone |
| SMILES | COc1ccc(OCCCN(C)C)c(C2Sc3ccccc3N2C(C)=O)c1 |
| InChI | InChI=1S/C21H26N2O3S/c1-15(24)23-18-8-5-6-9-20(18)27-21(23)17-14-16(25-4)10-11-19(17)26-13-7-12-22(2)3/h5-6,8-11,14,21H,7,12-13H2,1-4H3 |
| InChIKey | FXTZEUVNMZAREE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|