C31H45N3O3S — CID 54554250
2-[2-[4-[cyclohexyl(methyl)amino]butoxy]-5-methoxyphenyl]-4-[3-(dimethylamino)propyl]-1,4-benzothiazin-3-one (PubChem CID 54554250) has the molecular formula C31H45N3O3S and a molecular weight of 539.79 g/mol. Its IUPAC name is 2-[2-[4-[cyclohexyl(methyl)amino]butoxy]-5-methoxyphenyl]-4-[3-(dimethylamino)propyl]-1,4-benzothiazin-3-one.
| Compound Name | 2-[2-[4-[cyclohexyl(methyl)amino]butoxy]-5-methoxyphenyl]-4-[3-(dimethylamino)propyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 54554250 |
| Molecular Formula | C31H45N3O3S |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | 2-[2-[4-[cyclohexyl(methyl)amino]butoxy]-5-methoxyphenyl]-4-[3-(dimethylamino)propyl]-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(OCCCCN(C)C2CCCCC2)c(C2Sc3ccccc3N(CCCN(C)C)C2=O)c1 |
| InChI | InChI=1S/C31H45N3O3S/c1-32(2)19-12-21-34-27-15-8-9-16-29(27)38-30(31(34)35)26-23-25(36-4)17-18-28(26)37-22-11-10-20-33(3)24-13-6-5-7-14-24/h8-9,15-18,23-24,30H,5-7,10-14,19-22H2,1-4H3 |
| InChIKey | ZMAYNYUYOFMVJD-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|