C24H31ClN2O4S — CID 88542962
6-chloro-2-[5-methoxy-2-[3-[2-methoxyethyl(propan-2-yl)amino]propoxy]phenyl]-2H-1,3-benzothiazole-3-carbaldehyde (PubChem CID 88542962) has the molecular formula C24H31ClN2O4S and a molecular weight of 479.04 g/mol. Its IUPAC name is 6-chloro-2-[5-methoxy-2-[3-[2-methoxyethyl(propan-2-yl)amino]propoxy]phenyl]-2H-1,3-benzothiazole-3-carbaldehyde.
| Compound Name | 6-chloro-2-[5-methoxy-2-[3-[2-methoxyethyl(propan-2-yl)amino]propoxy]phenyl]-2H-1,3-benzothiazole-3-carbaldehyde |
|---|---|
| PubChem CID | 88542962 |
| Molecular Formula | C24H31ClN2O4S |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 6-chloro-2-[5-methoxy-2-[3-[2-methoxyethyl(propan-2-yl)amino]propoxy]phenyl]-2H-1,3-benzothiazole-3-carbaldehyde |
| SMILES | COCCN(CCCOc1ccc(OC)cc1C1Sc2cc(Cl)ccc2N1C=O)C(C)C |
| InChI | InChI=1S/C24H31ClN2O4S/c1-17(2)26(11-13-29-3)10-5-12-31-22-9-7-19(30-4)15-20(22)24-27(16-28)21-8-6-18(25)14-23(21)32-24/h6-9,14-17,24H,5,10-13H2,1-4H3 |
| InChIKey | GFKKITZGPVDUIL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|