C22H30N2O3S — CID 123564367
3-[2-(2,3-dihydro-1,3-benzothiazol-2-yl)-4-methoxyphenoxy]-N-ethyl-N-(2-methoxyethyl)propan-1-amine (PubChem CID 123564367) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1,3-benzothiazol-2-yl)-4-methoxyphenoxy]-N-ethyl-N-(2-methoxyethyl)propan-1-amine.
| Compound Name | 3-[2-(2,3-dihydro-1,3-benzothiazol-2-yl)-4-methoxyphenoxy]-N-ethyl-N-(2-methoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 123564367 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3-[2-(2,3-dihydro-1,3-benzothiazol-2-yl)-4-methoxyphenoxy]-N-ethyl-N-(2-methoxyethyl)propan-1-amine |
| SMILES | CCN(CCCOc1ccc(OC)cc1C1Nc2ccccc2S1)CCOC |
| InChI | InChI=1S/C22H30N2O3S/c1-4-24(13-15-25-2)12-7-14-27-20-11-10-17(26-3)16-18(20)22-23-19-8-5-6-9-21(19)28-22/h5-6,8-11,16,22-23H,4,7,12-15H2,1-3H3 |
| InChIKey | XUMUSUHIVSAUBH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|