C24H29N3O3S — CID 13335902
4-[2-(3-acetyl-2H-1,3-benzothiazol-2-yl)phenoxy]-1-(4-methylpiperazin-1-yl)butan-1-one (PubChem CID 13335902) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 4-[2-(3-acetyl-2H-1,3-benzothiazol-2-yl)phenoxy]-1-(4-methylpiperazin-1-yl)butan-1-one.
| Compound Name | 4-[2-(3-acetyl-2H-1,3-benzothiazol-2-yl)phenoxy]-1-(4-methylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 13335902 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 4-[2-(3-acetyl-2H-1,3-benzothiazol-2-yl)phenoxy]-1-(4-methylpiperazin-1-yl)butan-1-one |
| SMILES | CC(=O)N1c2ccccc2SC1c1ccccc1OCCCC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C24H29N3O3S/c1-18(28)27-20-9-4-6-11-22(20)31-24(27)19-8-3-5-10-21(19)30-17-7-12-23(29)26-15-13-25(2)14-16-26/h3-6,8-11,24H,7,12-17H2,1-2H3 |
| InChIKey | LLPTVUVQSZHUAD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|