C27H40N4O3 — CID 163553195
1-[4-(6-methoxycyclohexa-1,5-dien-1-yl)piperazin-1-yl]-5-[2-(4-methylpiperazin-1-yl)phenoxy]pentan-1-one (PubChem CID 163553195) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is 1-[4-(6-methoxycyclohexa-1,5-dien-1-yl)piperazin-1-yl]-5-[2-(4-methylpiperazin-1-yl)phenoxy]pentan-1-one.
| Compound Name | 1-[4-(6-methoxycyclohexa-1,5-dien-1-yl)piperazin-1-yl]-5-[2-(4-methylpiperazin-1-yl)phenoxy]pentan-1-one |
|---|---|
| PubChem CID | 163553195 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | 1-[4-(6-methoxycyclohexa-1,5-dien-1-yl)piperazin-1-yl]-5-[2-(4-methylpiperazin-1-yl)phenoxy]pentan-1-one |
| SMILES | COC1=CCCC=C1N1CCN(C(=O)CCCCOc2ccccc2N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C27H40N4O3/c1-28-14-16-29(17-15-28)24-10-4-6-12-26(24)34-22-8-7-13-27(32)31-20-18-30(19-21-31)23-9-3-5-11-25(23)33-2/h4,6,9-12H,3,5,7-8,13-22H2,1-2H3 |
| InChIKey | FKUXDXYIUPUSFJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|