C32H42N4O2 — CID 15838093
1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-[1-(4-methylpiperazin-1-yl)naphthalen-2-yl]oxypentan-1-one (PubChem CID 15838093) has the molecular formula C32H42N4O2 and a molecular weight of 514.71 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-[1-(4-methylpiperazin-1-yl)naphthalen-2-yl]oxypentan-1-one.
| Compound Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-[1-(4-methylpiperazin-1-yl)naphthalen-2-yl]oxypentan-1-one |
|---|---|
| PubChem CID | 15838093 |
| Molecular Formula | C32H42N4O2 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-[1-(4-methylpiperazin-1-yl)naphthalen-2-yl]oxypentan-1-one |
| SMILES | Cc1cccc(N2CCN(C(=O)CCCCOc3ccc4ccccc4c3N3CCN(C)CC3)CC2)c1C |
| InChI | InChI=1S/C32H42N4O2/c1-25-9-8-12-29(26(25)2)34-20-22-35(23-21-34)31(37)13-6-7-24-38-30-15-14-27-10-4-5-11-28(27)32(30)36-18-16-33(3)17-19-36/h4-5,8-12,14-15H,6-7,13,16-24H2,1-3H3 |
| InChIKey | KXICINQMEXQQTD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|