C29H42N4O2 — CID 67725879
5-[3-methyl-2-(4-methylpiperazin-1-yl)phenoxy]-1-[4-(2-phenylethyl)piperazin-1-yl]pentan-1-one (PubChem CID 67725879) has the molecular formula C29H42N4O2 and a molecular weight of 478.68 g/mol. Its IUPAC name is 5-[3-methyl-2-(4-methylpiperazin-1-yl)phenoxy]-1-[4-(2-phenylethyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-[3-methyl-2-(4-methylpiperazin-1-yl)phenoxy]-1-[4-(2-phenylethyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 67725879 |
| Molecular Formula | C29H42N4O2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | 5-[3-methyl-2-(4-methylpiperazin-1-yl)phenoxy]-1-[4-(2-phenylethyl)piperazin-1-yl]pentan-1-one |
| SMILES | Cc1cccc(OCCCCC(=O)N2CCN(CCc3ccccc3)CC2)c1N1CCN(C)CC1 |
| InChI | InChI=1S/C29H42N4O2/c1-25-9-8-12-27(29(25)33-20-16-30(2)17-21-33)35-24-7-6-13-28(34)32-22-18-31(19-23-32)15-14-26-10-4-3-5-11-26/h3-5,8-12H,6-7,13-24H2,1-2H3 |
| InChIKey | MQCDWCFGGMFTOD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|