C32H40N2O5S — CID 70428300
2-[2-[4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]butoxy]-5-methoxyphenyl]-2,4-dimethyl-1,4-benzothiazin-3-one (PubChem CID 70428300) has the molecular formula C32H40N2O5S and a molecular weight of 564.75 g/mol. Its IUPAC name is 2-[2-[4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]butoxy]-5-methoxyphenyl]-2,4-dimethyl-1,4-benzothiazin-3-one.
| Compound Name | 2-[2-[4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]butoxy]-5-methoxyphenyl]-2,4-dimethyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 70428300 |
| Molecular Formula | C32H40N2O5S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 2-[2-[4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]butoxy]-5-methoxyphenyl]-2,4-dimethyl-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(OCCCCN(C)CCc2ccc(OC)c(OC)c2)c(C2(C)Sc3ccccc3N(C)C2=O)c1 |
| InChI | InChI=1S/C32H40N2O5S/c1-32(31(35)34(3)26-11-7-8-12-30(26)40-32)25-22-24(36-4)14-16-27(25)39-20-10-9-18-33(2)19-17-23-13-15-28(37-5)29(21-23)38-6/h7-8,11-16,21-22H,9-10,17-20H2,1-6H3 |
| InChIKey | XWMXOMBQKVYOJM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|