C30H34N2O6S2 — CID 88522138
2-[2-[3-[2-(3H-1,2-benzodioxol-6-yloxy)ethyl-methylamino]propoxy]-5-methoxyphenyl]-4-methyl-2-methylsulfanyl-1,4-benzothiazin-3-one (PubChem CID 88522138) has the molecular formula C30H34N2O6S2 and a molecular weight of 582.74 g/mol. Its IUPAC name is 2-[2-[3-[2-(3H-1,2-benzodioxol-6-yloxy)ethyl-methylamino]propoxy]-5-methoxyphenyl]-4-methyl-2-methylsulfanyl-1,4-benzothiazin-3-one.
| Compound Name | 2-[2-[3-[2-(3H-1,2-benzodioxol-6-yloxy)ethyl-methylamino]propoxy]-5-methoxyphenyl]-4-methyl-2-methylsulfanyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 88522138 |
| Molecular Formula | C30H34N2O6S2 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 2-[2-[3-[2-(3H-1,2-benzodioxol-6-yloxy)ethyl-methylamino]propoxy]-5-methoxyphenyl]-4-methyl-2-methylsulfanyl-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(OCCCN(C)CCOc2ccc3c(c2)OOC3)c(C2(SC)Sc3ccccc3N(C)C2=O)c1 |
| InChI | InChI=1S/C30H34N2O6S2/c1-31(15-17-35-23-11-10-21-20-37-38-27(21)19-23)14-7-16-36-26-13-12-22(34-3)18-24(26)30(39-4)29(33)32(2)25-8-5-6-9-28(25)40-30/h5-6,8-13,18-19H,7,14-17,20H2,1-4H3 |
| InChIKey | ZBPZEUHZYVVGOX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|