C31H44N2O5S — CID 19600869
3-[4-[2-(3H-1,2-benzodioxol-6-yloxy)ethyl-methylamino]butyl]-2-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 19600869) has the molecular formula C31H44N2O5S and a molecular weight of 556.77 g/mol. Its IUPAC name is 3-[4-[2-(3H-1,2-benzodioxol-6-yloxy)ethyl-methylamino]butyl]-2-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-[4-[2-(3H-1,2-benzodioxol-6-yloxy)ethyl-methylamino]butyl]-2-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19600869 |
| Molecular Formula | C31H44N2O5S |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 3-[4-[2-(3H-1,2-benzodioxol-6-yloxy)ethyl-methylamino]butyl]-2-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CN(CCCCN1C(=O)CSC1c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)CCOc1ccc2c(c1)OOC2 |
| InChI | InChI=1S/C31H44N2O5S/c1-30(2,3)24-16-22(17-25(28(24)35)31(4,5)6)29-33(27(34)20-39-29)13-9-8-12-32(7)14-15-36-23-11-10-21-19-37-38-26(21)18-23/h10-11,16-18,29,35H,8-9,12-15,19-20H2,1-7H3 |
| InChIKey | FFQATJGUMSYSDQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|