C28H36N2O9S — CID 91354117
(2S)-3-[3-[2-(1,3-benzodioxol-5-yloxy)ethyl-methylamino]propyl]-2-(4-hydroxy-3,5-dimethylphenyl)-1,3-thiazolidin-4-one;(E)-4-hydroperoxybut-2-enoic acid (PubChem CID 91354117) has the molecular formula C28H36N2O9S and a molecular weight of 576.67 g/mol. Its IUPAC name is (2S)-3-[3-[2-(1,3-benzodioxol-5-yloxy)ethyl-methylamino]propyl]-2-(4-hydroxy-3,5-dimethylphenyl)-1,3-thiazolidin-4-one;(E)-4-hydroperoxybut-2-enoic acid.
| Compound Name | (2S)-3-[3-[2-(1,3-benzodioxol-5-yloxy)ethyl-methylamino]propyl]-2-(4-hydroxy-3,5-dimethylphenyl)-1,3-thiazolidin-4-one;(E)-4-hydroperoxybut-2-enoic acid |
|---|---|
| PubChem CID | 91354117 |
| Molecular Formula | C28H36N2O9S |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | (2S)-3-[3-[2-(1,3-benzodioxol-5-yloxy)ethyl-methylamino]propyl]-2-(4-hydroxy-3,5-dimethylphenyl)-1,3-thiazolidin-4-one;(E)-4-hydroperoxybut-2-enoic acid |
| SMILES | Cc1cc([C@@H]2SCC(=O)N2CCCN(C)CCOc2ccc3c(c2)OCO3)cc(C)c1O.O=C(O)/C=C/COO |
| InChI | InChI=1S/C24H30N2O5S.C4H6O4/c1-16-11-18(12-17(2)23(16)28)24-26(22(27)14-32-24)8-4-7-25(3)9-10-29-19-5-6-20-21(13-19)31-15-30-20;5-4(6)2-1-3-8-7/h5-6,11-13,24,28H,4,7-10,14-15H2,1-3H3;1-2,7H,3H2,(H,5,6)/b;2-1+/t24-;/m0./s1 |
| InChIKey | MNGQQZFHDLESOC-DSSYAJFBSA-N |
| XLogP | 3.83 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|