C17H24ClNO2S — CID 10664972
2-(3-tert-butyl-4-hydroxy-5-methylphenyl)-3-(3-chloropropyl)-1,3-thiazolidin-4-one (PubChem CID 10664972) has the molecular formula C17H24ClNO2S and a molecular weight of 341.90 g/mol. Its IUPAC name is 2-(3-tert-butyl-4-hydroxy-5-methylphenyl)-3-(3-chloropropyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-tert-butyl-4-hydroxy-5-methylphenyl)-3-(3-chloropropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10664972 |
| Molecular Formula | C17H24ClNO2S |
| Molecular Weight | 341.90 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-(3-tert-butyl-4-hydroxy-5-methylphenyl)-3-(3-chloropropyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C2SCC(=O)N2CCCCl)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C17H24ClNO2S/c1-11-8-12(9-13(15(11)21)17(2,3)4)16-19(7-5-6-18)14(20)10-22-16/h8-9,16,21H,5-7,10H2,1-4H3 |
| InChIKey | MLBDPEMGFKBXJT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.90 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|