C21H35BrN2O2S — CID 19600894
2-(3,5-ditert-butyl-4-hydroxyphenyl)-3-[3-(methylamino)propyl]-1,3-thiazolidin-4-one;hydrobromide (PubChem CID 19600894) has the molecular formula C21H35BrN2O2S and a molecular weight of 459.49 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-4-hydroxyphenyl)-3-[3-(methylamino)propyl]-1,3-thiazolidin-4-one;hydrobromide.
| Compound Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)-3-[3-(methylamino)propyl]-1,3-thiazolidin-4-one;hydrobromide |
|---|---|
| PubChem CID | 19600894 |
| Molecular Formula | C21H35BrN2O2S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)-3-[3-(methylamino)propyl]-1,3-thiazolidin-4-one;hydrobromide |
| SMILES | Br.CNCCCN1C(=O)CSC1c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H34N2O2S.BrH/c1-20(2,3)15-11-14(12-16(18(15)25)21(4,5)6)19-23(10-8-9-22-7)17(24)13-26-19;/h11-12,19,22,25H,8-10,13H2,1-7H3;1H |
| InChIKey | OGSCEMPGOLHCLT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|