C16H22ClNO2S — CID 10663999
3-(3-chloropropyl)-2-(3,5-diethyl-4-hydroxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 10663999) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is 3-(3-chloropropyl)-2-(3,5-diethyl-4-hydroxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(3-chloropropyl)-2-(3,5-diethyl-4-hydroxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10663999 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3-(3-chloropropyl)-2-(3,5-diethyl-4-hydroxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCc1cc(C2SCC(=O)N2CCCCl)cc(CC)c1O |
| InChI | InChI=1S/C16H22ClNO2S/c1-3-11-8-13(9-12(4-2)15(11)20)16-18(7-5-6-17)14(19)10-21-16/h8-9,16,20H,3-7,10H2,1-2H3 |
| InChIKey | QKRMIOOUEHCDDP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|