C23H21Cl3FN3O2S — CID 98176858
(5E)-5-[(2-fluorophenyl)methylidene]-3-[(1R)-2,2,2-trichloro-1-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 98176858) has the molecular formula C23H21Cl3FN3O2S and a molecular weight of 528.86 g/mol. Its IUPAC name is (5E)-5-[(2-fluorophenyl)methylidene]-3-[(1R)-2,2,2-trichloro-1-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-fluorophenyl)methylidene]-3-[(1R)-2,2,2-trichloro-1-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 98176858 |
| Molecular Formula | C23H21Cl3FN3O2S |
| Molecular Weight | 528.86 g/mol |
| Exact Mass | 527.04 |
| IUPAC Name | (5E)-5-[(2-fluorophenyl)methylidene]-3-[(1R)-2,2,2-trichloro-1-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(N2CCN([C@H](N3C(=O)S/C(=C/c4ccccc4F)C3=O)C(Cl)(Cl)Cl)CC2)cc1 |
| InChI | InChI=1S/C23H21Cl3FN3O2S/c1-15-6-8-17(9-7-15)28-10-12-29(13-11-28)21(23(24,25)26)30-20(31)19(33-22(30)32)14-16-4-2-3-5-18(16)27/h2-9,14,21H,10-13H2,1H3/b19-14+/t21-/m1/s1 |
| InChIKey | WDGXYHPBHRNAPV-CKNGIZQFSA-N |
| XLogP | 5.69 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.86 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|