C26H26Cl3N3O3S — CID 98176863
(5E)-5-[(2-prop-2-enoxyphenyl)methylidene]-3-[(1S)-2,2,2-trichloro-1-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 98176863) has the molecular formula C26H26Cl3N3O3S and a molecular weight of 566.94 g/mol. Its IUPAC name is (5E)-5-[(2-prop-2-enoxyphenyl)methylidene]-3-[(1S)-2,2,2-trichloro-1-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-prop-2-enoxyphenyl)methylidene]-3-[(1S)-2,2,2-trichloro-1-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 98176863 |
| Molecular Formula | C26H26Cl3N3O3S |
| Molecular Weight | 566.94 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | (5E)-5-[(2-prop-2-enoxyphenyl)methylidene]-3-[(1S)-2,2,2-trichloro-1-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCOc1ccccc1/C=C1/SC(=O)N([C@H](N2CCN(c3ccc(C)cc3)CC2)C(Cl)(Cl)Cl)C1=O |
| InChI | InChI=1S/C26H26Cl3N3O3S/c1-3-16-35-21-7-5-4-6-19(21)17-22-23(33)32(25(34)36-22)24(26(27,28)29)31-14-12-30(13-15-31)20-10-8-18(2)9-11-20/h3-11,17,24H,1,12-16H2,2H3/b22-17+/t24-/m0/s1 |
| InChIKey | QEWFAIIORWJRKC-INOOMSPWSA-N |
| XLogP | 6.11 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.94 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|