C26H23ClN2O4 — CID 98181092
2-chloro-N-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[(2R)-1-oxo-1-phenylbutan-2-yl]benzamide (PubChem CID 98181092) has the molecular formula C26H23ClN2O4 and a molecular weight of 462.93 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[(2R)-1-oxo-1-phenylbutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[(2R)-1-oxo-1-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 98181092 |
| Molecular Formula | C26H23ClN2O4 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2-chloro-N-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[(2R)-1-oxo-1-phenylbutan-2-yl]benzamide |
| SMILES | CC[C@H](C(=O)c1ccccc1)N(C(=O)c1ccccc1Cl)N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C26H23ClN2O4/c1-2-20(23(30)15-8-4-3-5-9-15)28(24(31)18-10-6-7-11-19(18)27)29-25(32)21-16-12-13-17(14-16)22(21)26(29)33/h3-13,16-17,20-22H,2,14H2,1H3/t16-,17-,20+,21-,22+/m0/s1 |
| InChIKey | SUJOJAVRSNWKMQ-RGBOINFLSA-N |
| XLogP | 4.17 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|