C24H31ClN8O4S — CID 98182543
(2S)-4-[6-chloro-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]sulfanylpyrimidin-4-yl]-N-ethyl-2-methylpiperazine-1-carboxamide (PubChem CID 98182543) has the molecular formula C24H31ClN8O4S and a molecular weight of 563.08 g/mol. Its IUPAC name is (2S)-4-[6-chloro-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]sulfanylpyrimidin-4-yl]-N-ethyl-2-methylpiperazine-1-carboxamide.
| Compound Name | (2S)-4-[6-chloro-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]sulfanylpyrimidin-4-yl]-N-ethyl-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 98182543 |
| Molecular Formula | C24H31ClN8O4S |
| Molecular Weight | 563.08 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | (2S)-4-[6-chloro-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]sulfanylpyrimidin-4-yl]-N-ethyl-2-methylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(c2cc(Cl)nc(SCC(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)n2)C[C@@H]1C |
| InChI | InChI=1S/C24H31ClN8O4S/c1-3-26-24(35)32-13-12-31(15-17(32)2)21-14-20(25)27-23(28-21)38-16-22(34)30-10-8-29(9-11-30)18-4-6-19(7-5-18)33(36)37/h4-7,14,17H,3,8-13,15-16H2,1-2H3,(H,26,35)/t17-/m0/s1 |
| InChIKey | SFJZVTNDVGDUHS-KRWDZBQOSA-N |
| XLogP | 2.72 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.08 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|