C31H34N4O7 — CID 98183369
(3R,4S)-3-(4-ethoxyphenyl)-N-(2-methoxy-5-nitrophenyl)-2-(2-morpholin-4-ylethyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 98183369) has the molecular formula C31H34N4O7 and a molecular weight of 574.63 g/mol. Its IUPAC name is (3R,4S)-3-(4-ethoxyphenyl)-N-(2-methoxy-5-nitrophenyl)-2-(2-morpholin-4-ylethyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4S)-3-(4-ethoxyphenyl)-N-(2-methoxy-5-nitrophenyl)-2-(2-morpholin-4-ylethyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 98183369 |
| Molecular Formula | C31H34N4O7 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | (3R,4S)-3-(4-ethoxyphenyl)-N-(2-methoxy-5-nitrophenyl)-2-(2-morpholin-4-ylethyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CCOc1ccc([C@H]2[C@@H](C(=O)Nc3cc([N+](=O)[O-])ccc3OC)c3ccccc3C(=O)N2CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C31H34N4O7/c1-3-42-23-11-8-21(9-12-23)29-28(30(36)32-26-20-22(35(38)39)10-13-27(26)40-2)24-6-4-5-7-25(24)31(37)34(29)15-14-33-16-18-41-19-17-33/h4-13,20,28-29H,3,14-19H2,1-2H3,(H,32,36)/t28-,29-/m0/s1 |
| InChIKey | BTUQPSHMEDSOGO-VMPREFPWSA-N |
| XLogP | 4.25 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|