C16H23N3O2 — CID 98184642
1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-[(2R)-1-methoxypropan-2-yl]urea (PubChem CID 98184642) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-[(2R)-1-methoxypropan-2-yl]urea.
| Compound Name | 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-[(2R)-1-methoxypropan-2-yl]urea |
|---|---|
| PubChem CID | 98184642 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-[(2R)-1-methoxypropan-2-yl]urea |
| SMILES | COC[C@@H](C)NC(=O)NCc1ccc(N2CC=CC2)cc1 |
| InChI | InChI=1S/C16H23N3O2/c1-13(12-21-2)18-16(20)17-11-14-5-7-15(8-6-14)19-9-3-4-10-19/h3-8,13H,9-12H2,1-2H3,(H2,17,18,20)/t13-/m1/s1 |
| InChIKey | ZDLXFOGWIQPSPJ-CYBMUJFWSA-N |
| XLogP | 1.90 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|