C14H10F4N2O2 — CID 98185532
(2R)-2-cyano-3-[4-fluoro-3-(trifluoromethyl)phenyl]-3-oxo-N-prop-2-enylpropanamide (PubChem CID 98185532) has the molecular formula C14H10F4N2O2 and a molecular weight of 314.24 g/mol. Its IUPAC name is (2R)-2-cyano-3-[4-fluoro-3-(trifluoromethyl)phenyl]-3-oxo-N-prop-2-enylpropanamide.
| Compound Name | (2R)-2-cyano-3-[4-fluoro-3-(trifluoromethyl)phenyl]-3-oxo-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 98185532 |
| Molecular Formula | C14H10F4N2O2 |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (2R)-2-cyano-3-[4-fluoro-3-(trifluoromethyl)phenyl]-3-oxo-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@H](C#N)C(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F4N2O2/c1-2-5-20-13(22)9(7-19)12(21)8-3-4-11(15)10(6-8)14(16,17)18/h2-4,6,9H,1,5H2,(H,20,22)/t9-/m1/s1 |
| InChIKey | VQYDSJGDLYXILN-SECBINFHSA-N |
| XLogP | 2.47 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|