C23H27N5O7S2 — CID 98186566
2-[5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(2-methoxy-5-nitrophenyl)acetamide (PubChem CID 98186566) has the molecular formula C23H27N5O7S2 and a molecular weight of 549.63 g/mol. Its IUPAC name is 2-[5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(2-methoxy-5-nitrophenyl)acetamide.
| Compound Name | 2-[5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(2-methoxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 98186566 |
| Molecular Formula | C23H27N5O7S2 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | 2-[5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-(2-methoxy-5-nitrophenyl)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)Cn1cnc2sc(C)c(S(=O)(=O)N3C[C@H](C)C[C@@H](C)C3)c2c1=O |
| InChI | InChI=1S/C23H27N5O7S2/c1-13-7-14(2)10-27(9-13)37(33,34)21-15(3)36-22-20(21)23(30)26(12-24-22)11-19(29)25-17-8-16(28(31)32)5-6-18(17)35-4/h5-6,8,12-14H,7,9-11H2,1-4H3,(H,25,29)/t13-,14-/m1/s1 |
| InChIKey | ZZXYAPDBDOHMBV-ZIAGYGMSSA-N |
| XLogP | 2.99 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|