C24H36N4O4S2 — CID 98460613
N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide (PubChem CID 98460613) has the molecular formula C24H36N4O4S2 and a molecular weight of 508.71 g/mol. Its IUPAC name is N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide.
| Compound Name | N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 98460613 |
| Molecular Formula | C24H36N4O4S2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-[5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide |
| SMILES | Cc1sc2ncn(CC(=O)N[C@@H]3CCC[C@H](C)[C@@H]3C)c(=O)c2c1S(=O)(=O)N1C[C@@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C24H36N4O4S2/c1-14-9-15(2)11-28(10-14)34(31,32)22-18(5)33-23-21(22)24(30)27(13-25-23)12-20(29)26-19-8-6-7-16(3)17(19)4/h13-17,19H,6-12H2,1-5H3,(H,26,29)/t14-,15-,16-,17-,19+/m0/s1 |
| InChIKey | ZQYIYROGKDLTEP-BRFLTPSNSA-N |
| XLogP | 3.37 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |